C46H79O11P — CID 156972970
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate (PubChem CID 156972970) has the molecular formula C46H79O11P and a molecular weight of 839.10 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
|---|---|
| PubChem CID | 156972970 |
| Molecular Formula | C46H79O11P |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.54 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] (5E,7Z,11Z,14Z)-9-hydroxyicosa-5,7,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C=C\C(O)C/C=C\C/C=C\CCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C46H79O11P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-22-24-28-33-37-46(51)57-44(41-56-58(52,53)55-39-43(49)38-47)40-54-45(50)36-32-29-25-27-31-35-42(48)34-30-26-23-21-12-10-8-6-4-2/h11-13,15-16,21,25-27,30-31,35,42-44,47-49H,3-10,14,17-20,22-24,28-29,32-34,36-41H2,1-2H3,(H,52,53)/b13-11-,16-15-,21-12-,27-25+,30-26-,35-31-/t42?,43-,44+/m0/s1 |
| InChIKey | OAKKMTXQXZFNLQ-UOHRUTFMSA-N |
| XLogP | 10.64 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.10 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|