C42H71O11P — CID 156972725
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 156972725) has the molecular formula C42H71O11P and a molecular weight of 782.99 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 156972725 |
| Molecular Formula | C42H71O11P |
| Molecular Weight | 782.99 g/mol |
| Exact Mass | 782.47 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(6Z,9Z,12Z)-octadeca-6,9,12-trienoyl]oxypropan-2-yl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C42H71O11P/c1-3-5-7-8-9-10-11-12-13-14-15-18-21-24-28-32-41(46)50-36-40(37-52-54(48,49)51-35-39(45)34-43)53-42(47)33-29-25-22-19-16-17-20-23-27-31-38(44)30-26-6-4-2/h6,9-10,12-13,15,18,20,23,26-27,31,38-40,43-45H,3-5,7-8,11,14,16-17,19,21-22,24-25,28-30,32-37H2,1-2H3,(H,48,49)/b10-9-,13-12-,18-15-,23-20+,26-6+,31-27+/t38?,39-,40+/m0/s1 |
| InChIKey | AAZNLHFPVAFKJK-SDXQRWBWSA-N |
| XLogP | 9.08 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.99 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|