C46H81O11P — CID 156972847
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 156972847) has the molecular formula C46H81O11P and a molecular weight of 841.12 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156972847 |
| Molecular Formula | C46H81O11P |
| Molecular Weight | 841.12 g/mol |
| Exact Mass | 840.55 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-icos-11-enoyl]oxypropan-2-yl] (5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCO |
| InChI | InChI=1S/C46H81O11P/c1-2-3-4-5-6-7-8-9-10-12-15-18-21-24-27-30-33-36-45(50)54-41-44(42-56-58(52,53)55-40-43(49)39-48)57-46(51)37-34-31-28-25-22-19-16-13-11-14-17-20-23-26-29-32-35-38-47/h9-11,14,16,19-20,23,25,28,43-44,47-49H,2-8,12-13,15,17-18,21-22,24,26-27,29-42H2,1H3,(H,52,53)/b10-9-,14-11-,19-16-,23-20-,28-25-/t43-,44+/m0/s1 |
| InChIKey | YQMNWZMGUDQKSD-LPMUDVNNSA-N |
| XLogP | 10.86 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.12 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|