C46H79O11P — CID 156973148
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156973148) has the molecular formula C46H79O11P and a molecular weight of 839.10 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156973148 |
| Molecular Formula | C46H79O11P |
| Molecular Weight | 839.10 g/mol |
| Exact Mass | 838.54 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxypropan-2-yl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCCCCCC/C=C\C/C=C\C/C=C\CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCC(O)/C=C/C=C/C/C=C/CCCCCCCC |
| InChI | InChI=1S/C46H79O11P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-36-45(50)54-40-44(41-56-58(52,53)55-39-43(49)38-47)57-46(51)37-33-35-42(48)34-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h17-18,20-23,26-29,31,34,42-44,47-49H,3-16,19,24-25,30,32-33,35-41H2,1-2H3,(H,52,53)/b18-17-,22-20-,23-21+,28-26-,29-27+,34-31+/t42?,43-,44+/m0/s1 |
| InChIKey | ZGONEEBXNREMFW-ZXIQXVCXSA-N |
| XLogP | 10.64 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.10 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|