C38H67O11P — CID 156974408
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoate (PubChem CID 156974408) has the molecular formula C38H67O11P and a molecular weight of 730.92 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156974408 |
| Molecular Formula | C38H67O11P |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 730.44 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-(10-methylundecanoyloxy)propyl] (5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)(O)OC[C@@H](O)CO)OC(=O)CCCCCCCCC(C)C |
| InChI | InChI=1S/C38H67O11P/c1-4-5-6-7-8-9-10-11-12-13-14-18-21-25-34(40)26-23-28-37(42)46-31-36(32-48-50(44,45)47-30-35(41)29-39)49-38(43)27-22-19-16-15-17-20-24-33(2)3/h8-9,11-12,14,18,21,25,33-36,39-41H,4-7,10,13,15-17,19-20,22-24,26-32H2,1-3H3,(H,44,45)/b9-8-,12-11-,18-14-,25-21+/t34-,35+,36-/m1/s1 |
| InChIKey | XDXPCGGKDMUBAD-FZHUJKMISA-N |
| XLogP | 7.82 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|