C44H80O15P2 — CID 156976102
[(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate (PubChem CID 156976102) has the molecular formula C44H80O15P2 and a molecular weight of 911.06 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate.
| Compound Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 156976102 |
| Molecular Formula | C44H80O15P2 |
| Molecular Weight | 911.06 g/mol |
| Exact Mass | 910.50 |
| IUPAC Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O)C(O)CCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C44H80O15P2/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-33-43(48)55-37-40(38-58-61(53,54)57-36-39(45)35-56-60(50,51)52)59-44(49)34-30-32-42(47)41(46)31-28-26-24-22-20-16-14-12-10-8-6-4-2/h12,14,17-18,20,22,26,28,39-42,45-47H,3-11,13,15-16,19,21,23-25,27,29-38H2,1-2H3,(H,53,54)(H2,50,51,52)/b14-12-,18-17-,22-20-,28-26-/t39-,40+,41?,42?/m0/s1 |
| InChIKey | LKFNTXUJNXTTRZ-GSQJOOQESA-N |
| XLogP | 9.39 |
| TPSA | 235.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.06 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|