C42H80O15P2 — CID 156976114
[(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate (PubChem CID 156976114) has the molecular formula C42H80O15P2 and a molecular weight of 887.03 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate.
| Compound Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
|---|---|
| PubChem CID | 156976114 |
| Molecular Formula | C42H80O15P2 |
| Molecular Weight | 887.03 g/mol |
| Exact Mass | 886.50 |
| IUPAC Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z,9S,10S)-9,10-dihydroxyoctadec-12-enoate |
| SMILES | CCCCC/C=C\C[C@H](O)[C@@H](O)CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCCCC)COP(=O)(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C42H80O15P2/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-23-27-31-41(46)53-35-38(36-56-59(51,52)55-34-37(43)33-54-58(48,49)50)57-42(47)32-28-24-20-22-26-30-40(45)39(44)29-25-21-10-8-6-4-2/h14-15,21,25,37-40,43-45H,3-13,16-20,22-24,26-36H2,1-2H3,(H,51,52)(H2,48,49,50)/b15-14-,25-21-/t37-,38+,39-,40-/m0/s1 |
| InChIKey | JNSAPXXOAYBJGX-FNKMVITHSA-N |
| XLogP | 9.06 |
| TPSA | 235.81 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 887.03 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|