C42H79O12P — CID 138154205
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z)-12,13-dihydroxyoctadec-9-enoate (PubChem CID 138154205) has the molecular formula C42H79O12P and a molecular weight of 807.06 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z)-12,13-dihydroxyoctadec-9-enoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z)-12,13-dihydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 138154205 |
| Molecular Formula | C42H79O12P |
| Molecular Weight | 807.06 g/mol |
| Exact Mass | 806.53 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-octadec-9-enoyl]oxypropan-2-yl] (Z)-12,13-dihydroxyoctadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCC/C=C\CC(O)C(O)CCCCC |
| InChI | InChI=1S/C42H79O12P/c1-3-5-7-8-9-10-11-12-13-14-15-16-20-23-27-31-41(47)51-35-38(36-53-55(49,50)52-34-37(44)33-43)54-42(48)32-28-24-21-18-17-19-22-26-30-40(46)39(45)29-25-6-4-2/h12-13,22,26,37-40,43-46H,3-11,14-21,23-25,27-36H2,1-2H3,(H,49,50)/b13-12-,26-22- |
| InChIKey | FOYIYTQHDINCJH-NJZKSKOUSA-N |
| XLogP | 8.94 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.06 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|