C42H73O12P — CID 156972085
[(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate (PubChem CID 156972085) has the molecular formula C42H73O12P and a molecular weight of 801.01 g/mol. Its IUPAC name is [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate.
| Compound Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
|---|---|
| PubChem CID | 156972085 |
| Molecular Formula | C42H73O12P |
| Molecular Weight | 801.01 g/mol |
| Exact Mass | 800.48 |
| IUPAC Name | [(2R)-1-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-3-[(Z)-hexadec-9-enoyl]oxypropan-2-yl] (5R,6R,8Z,11Z,14Z,17Z)-5,6-dihydroxyicosa-8,11,14,17-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H](O)[C@H](O)CCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C42H73O12P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-31-41(47)51-35-38(36-53-55(49,50)52-34-37(44)33-43)54-42(48)32-28-30-40(46)39(45)29-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12-15,18,20,24,26,37-40,43-46H,3-5,7,9-11,16-17,19,21-23,25,27-36H2,1-2H3,(H,49,50)/b8-6-,14-12-,15-13-,20-18-,26-24-/t37-,38+,39+,40+/m0/s1 |
| InChIKey | KMDBKFDJYFBTBV-JRKMUILSSA-N |
| XLogP | 8.27 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.01 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|