C46H77O12P — CID 156973301
[(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate (PubChem CID 156973301) has the molecular formula C46H77O12P and a molecular weight of 853.08 g/mol. Its IUPAC name is [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate.
| Compound Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
|---|---|
| PubChem CID | 156973301 |
| Molecular Formula | C46H77O12P |
| Molecular Weight | 853.08 g/mol |
| Exact Mass | 852.52 |
| IUPAC Name | [(2R)-3-[[(2S)-2,3-dihydroxypropoxy]-hydroxyphosphoryl]oxy-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxypropyl] (8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCC(O)C(O)C/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)OC[C@@H](O)CO |
| InChI | InChI=1S/C46H77O12P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-35-46(52)58-42(40-57-59(53,54)56-38-41(48)37-47)39-55-45(51)36-32-34-44(50)43(49)33-30-28-26-24-22-16-14-12-10-8-6-4-2/h11-14,17-18,20-22,24-25,27-28,30,41-44,47-50H,3-10,15-16,19,23,26,29,31-40H2,1-2H3,(H,53,54)/b13-11-,14-12-,18-17-,21-20-,24-22-,27-25-,30-28-/t41-,42+,43?,44?/m0/s1 |
| InChIKey | QGBKEDHGHOIGLX-BHFUKINWSA-N |
| XLogP | 9.39 |
| TPSA | 189.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.08 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|