C38H66O14P2 — CID 156978183
[(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate (PubChem CID 156978183) has the molecular formula C38H66O14P2 and a molecular weight of 808.88 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156978183 |
| Molecular Formula | C38H66O14P2 |
| Molecular Weight | 808.88 g/mol |
| Exact Mass | 808.39 |
| IUPAC Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O[C@H](COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C38H66O14P2/c1-4-5-6-7-8-9-10-11-12-13-14-18-21-25-34(39)26-23-28-38(42)52-36(31-48-37(41)27-22-19-16-15-17-20-24-33(2)3)32-51-54(46,47)50-30-35(40)29-49-53(43,44)45/h8-9,11-12,14,18,21,25,33,35-36,40H,4-7,10,13,15-17,19-20,22-24,26-32H2,1-3H3,(H,46,47)(H2,43,44,45)/b9-8-,12-11-,18-14-,25-21+/t35-,36+/m0/s1 |
| InChIKey | DHMGMGNXRSGRIQ-DLFMMUECSA-N |
| XLogP | 8.15 |
| TPSA | 212.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.88 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|