C36H66O14P2 — CID 156978187
[(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156978187) has the molecular formula C36H66O14P2 and a molecular weight of 784.86 g/mol. Its IUPAC name is [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156978187 |
| Molecular Formula | C36H66O14P2 |
| Molecular Weight | 784.86 g/mol |
| Exact Mass | 784.39 |
| IUPAC Name | [(2R)-1-[hydroxy-[(2S)-2-hydroxy-3-phosphonooxypropoxy]phosphoryl]oxy-3-(10-methylundecanoyloxy)propan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC(C)C)COP(=O)(O)OC[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C36H66O14P2/c1-4-5-6-7-8-13-18-23-32(37)24-19-14-11-16-21-26-36(40)50-34(29-46-35(39)25-20-15-10-9-12-17-22-31(2)3)30-49-52(44,45)48-28-33(38)27-47-51(41,42)43/h8,13,18,23,31,33-34,38H,4-7,9-12,14-17,19-22,24-30H2,1-3H3,(H,44,45)(H2,41,42,43)/b13-8-,23-18+/t33-,34+/m0/s1 |
| InChIKey | JARGALMFYBEKQF-MDNHCNTLSA-N |
| XLogP | 7.81 |
| TPSA | 212.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.86 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|