C34H61O9P — CID 156970822
[(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156970822) has the molecular formula C34H61O9P and a molecular weight of 644.83 g/mol. Its IUPAC name is [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156970822 |
| Molecular Formula | C34H61O9P |
| Molecular Weight | 644.83 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | [(2R)-2-(11-methyldodecanoyloxy)-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCCCCC(C)C |
| InChI | InChI=1S/C34H61O9P/c1-4-5-6-7-9-14-19-24-31(35)25-20-15-12-17-21-26-33(36)41-28-32(29-42-44(38,39)40)43-34(37)27-22-16-11-8-10-13-18-23-30(2)3/h9,14,19,24,30,32H,4-8,10-13,15-18,20-23,25-29H2,1-3H3,(H2,38,39,40)/b14-9-,24-19+/t32-/m1/s1 |
| InChIKey | PLMOJLLLMHDNQJ-BKSKOAMCSA-N |
| XLogP | 8.71 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.83 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|