C39H69O9P — CID 156967083
[(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156967083) has the molecular formula C39H69O9P and a molecular weight of 712.95 g/mol. Its IUPAC name is [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156967083 |
| Molecular Formula | C39H69O9P |
| Molecular Weight | 712.95 g/mol |
| Exact Mass | 712.47 |
| IUPAC Name | [(2R)-1-[(Z)-octadec-11-enoyl]oxy-3-phosphonooxypropan-2-yl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H69O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-24-28-32-38(41)46-34-37(35-47-49(43,44)45)48-39(42)33-29-25-21-23-27-31-36(40)30-26-22-19-10-8-6-4-2/h12-13,19,22,26,30,37H,3-11,14-18,20-21,23-25,27-29,31-35H2,1-2H3,(H2,43,44,45)/b13-12-,22-19-,30-26+/t37-/m1/s1 |
| InChIKey | FRDKSEBMERXYIS-OUKWIKPASA-N |
| XLogP | 10.58 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.95 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|