C41H67O9P — CID 156967394
[(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate (PubChem CID 156967394) has the molecular formula C41H67O9P and a molecular weight of 734.95 g/mol. Its IUPAC name is [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate.
| Compound Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
|---|---|
| PubChem CID | 156967394 |
| Molecular Formula | C41H67O9P |
| Molecular Weight | 734.95 g/mol |
| Exact Mass | 734.45 |
| IUPAC Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-phosphonooxypropyl] (5Z,8Z,11Z,13E)-15-oxoicosa-5,8,11,13-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C41H67O9P/c1-3-5-7-8-9-10-11-12-13-14-17-21-24-27-31-35-41(44)50-39(37-49-51(45,46)47)36-48-40(43)34-30-26-23-20-18-15-16-19-22-25-29-33-38(42)32-28-6-4-2/h9-10,12-13,15-16,20,22-23,25,29,33,39H,3-8,11,14,17-19,21,24,26-28,30-32,34-37H2,1-2H3,(H2,45,46,47)/b10-9-,13-12-,16-15-,23-20-,25-22-,33-29+/t39-/m1/s1 |
| InChIKey | CMGDCRWPQFVBEW-HDEDTKAUSA-N |
| XLogP | 10.69 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.95 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|