C43H67O9P — CID 156968533
[(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate (PubChem CID 156968533) has the molecular formula C43H67O9P and a molecular weight of 758.97 g/mol. Its IUPAC name is [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156968533 |
| Molecular Formula | C43H67O9P |
| Molecular Weight | 758.97 g/mol |
| Exact Mass | 758.45 |
| IUPAC Name | [(2R)-1-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]oxy-3-phosphonooxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C43H67O9P/c1-3-5-7-9-11-13-15-17-18-19-20-22-24-26-28-30-32-36-42(45)50-38-41(39-51-53(47,48)49)52-43(46)37-33-35-40(44)34-31-29-27-25-23-21-16-14-12-10-8-6-4-2/h11-14,17-18,20-23,26-29,31,34,41H,3-10,15-16,19,24-25,30,32-33,35-39H2,1-2H3,(H2,47,48,49)/b13-11-,14-12-,18-17-,22-20-,23-21-,28-26-,29-27-,34-31+/t41-/m1/s1 |
| InChIKey | SLHCSGQOBMNASP-DHFJZFBASA-N |
| XLogP | 11.02 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.97 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|