C41H71O9P — CID 156968228
[(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (11Z,14Z)-icosa-11,14-dienoate (PubChem CID 156968228) has the molecular formula C41H71O9P and a molecular weight of 738.98 g/mol. Its IUPAC name is [(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (11Z,14Z)-icosa-11,14-dienoate.
| Compound Name | [(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
|---|---|
| PubChem CID | 156968228 |
| Molecular Formula | C41H71O9P |
| Molecular Weight | 738.98 g/mol |
| Exact Mass | 738.48 |
| IUPAC Name | [(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-phosphonooxypropyl] (11Z,14Z)-icosa-11,14-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC |
| InChI | InChI=1S/C41H71O9P/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-20-23-26-30-34-40(43)48-36-39(37-49-51(45,46)47)50-41(44)35-31-27-24-21-18-19-22-25-29-33-38(42)32-28-6-4-2/h9-10,12-13,22,25,29,33,39H,3-8,11,14-21,23-24,26-28,30-32,34-37H2,1-2H3,(H2,45,46,47)/b10-9-,13-12-,25-22-,33-29+/t39-/m1/s1 |
| InChIKey | BORJPZHDXXSHTL-ZYEFBJAUSA-N |
| XLogP | 11.14 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.98 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|