C37H61O9P — CID 156966456
[(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate (PubChem CID 156966456) has the molecular formula C37H61O9P and a molecular weight of 680.86 g/mol. Its IUPAC name is [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156966456 |
| Molecular Formula | C37H61O9P |
| Molecular Weight | 680.86 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | [(2R)-1-phosphonooxy-3-[(Z)-tetradec-9-enoyl]oxypropan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCCC(=O)/C=C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C37H61O9P/c1-3-5-7-9-11-13-15-16-18-19-21-23-25-28-34(38)29-27-31-37(40)46-35(33-45-47(41,42)43)32-44-36(39)30-26-24-22-20-17-14-12-10-8-6-4-2/h10-13,16,18,21,23,25,28,35H,3-9,14-15,17,19-20,22,24,26-27,29-33H2,1-2H3,(H2,41,42,43)/b12-10-,13-11-,18-16-,23-21-,28-25+/t35-/m1/s1 |
| InChIKey | LQNAZZQCNPTHFP-UPIPKYGISA-N |
| XLogP | 9.35 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.86 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|