C39H65O9P — CID 156967603
[(2R)-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate (PubChem CID 156967603) has the molecular formula C39H65O9P and a molecular weight of 708.91 g/mol. Its IUPAC name is [(2R)-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate.
| Compound Name | [(2R)-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
|---|---|
| PubChem CID | 156967603 |
| Molecular Formula | C39H65O9P |
| Molecular Weight | 708.91 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | [(2R)-2-[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]oxy-3-phosphonooxypropyl] (10E,12Z)-9-oxooctadeca-10,12-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCC(=O)/C=C/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H65O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-20-24-29-33-39(42)48-37(35-47-49(43,44)45)34-46-38(41)32-28-25-21-23-27-31-36(40)30-26-22-19-10-8-6-4-2/h5,7,11-12,14-15,19,22,26,30,37H,3-4,6,8-10,13,16-18,20-21,23-25,27-29,31-35H2,1-2H3,(H2,43,44,45)/b7-5-,12-11-,15-14-,22-19-,30-26+/t37-/m1/s1 |
| InChIKey | ROOHPAJLVIKCPT-FTQISEIYSA-N |
| XLogP | 10.13 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.91 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|