C45H78NO10P — CID 156988101
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156988101) has the molecular formula C45H78NO10P and a molecular weight of 824.09 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156988101 |
| Molecular Formula | C45H78NO10P |
| Molecular Weight | 824.09 g/mol |
| Exact Mass | 823.54 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCCCCCC/C=C/C/C=C/C=C/C(O)CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C |
| InChI | InChI=1S/C45H78NO10P/c1-5-7-8-9-10-11-12-13-14-15-18-21-24-29-40(47)30-27-33-44(48)52-36-41(37-54-57(50,51)53-35-34-46)55-45(49)32-26-23-20-17-16-19-22-25-31-43-39(4)38(3)42(56-43)28-6-2/h13-14,18,21,24,29,40-41,47H,5-12,15-17,19-20,22-23,25-28,30-37,46H2,1-4H3,(H,50,51)/b14-13+,21-18+,29-24+/t40?,41-/m1/s1 |
| InChIKey | FHISKMWCESEXHS-KMINVJBXSA-N |
| XLogP | 10.79 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.09 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|