C43H74NO10P — CID 156988413
[(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate (PubChem CID 156988413) has the molecular formula C43H74NO10P and a molecular weight of 796.04 g/mol. Its IUPAC name is [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate.
| Compound Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
|---|---|
| PubChem CID | 156988413 |
| Molecular Formula | C43H74NO10P |
| Molecular Weight | 796.04 g/mol |
| Exact Mass | 795.51 |
| IUPAC Name | [(2R)-3-[2-aminoethoxy(hydroxy)phosphoryl]oxy-2-[9-(3,4-dimethyl-5-propylfuran-2-yl)nonanoyloxy]propyl] (6E,8E,11E)-5-hydroxyicosa-6,8,11-trienoate |
| SMILES | CCCCCCCC/C=C/C/C=C/C=C/C(O)CCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(=O)CCCCCCCCc1oc(CCC)c(C)c1C |
| InChI | InChI=1S/C43H74NO10P/c1-5-7-8-9-10-11-12-13-14-15-16-19-22-27-38(45)28-25-31-42(46)50-34-39(35-52-55(48,49)51-33-32-44)53-43(47)30-24-21-18-17-20-23-29-41-37(4)36(3)40(54-41)26-6-2/h13-14,16,19,22,27,38-39,45H,5-12,15,17-18,20-21,23-26,28-35,44H2,1-4H3,(H,48,49)/b14-13+,19-16+,27-22+/t38?,39-/m1/s1 |
| InChIKey | CQZUGFRZGZNGMU-IHJUWQHGSA-N |
| XLogP | 10.01 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.04 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|