C43H74NO8P — CID 156988776
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate (PubChem CID 156988776) has the molecular formula C43H74NO8P and a molecular weight of 764.04 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 156988776 |
| Molecular Formula | C43H74NO8P |
| Molecular Weight | 764.04 g/mol |
| Exact Mass | 763.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O[C@H](CO/C=C/CCCCCCCC/C=C\CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C43H74NO8P/c1-3-5-7-9-11-13-15-17-18-19-21-23-25-27-29-31-37-49-39-42(40-51-53(47,48)50-38-36-44)52-43(46)35-32-34-41(45)33-30-28-26-24-22-20-16-14-12-10-8-6-4-2/h12-15,20,22,26,28,30-31,33,37,42H,3-11,16-19,21,23-25,27,29,32,34-36,38-40,44H2,1-2H3,(H,47,48)/b14-12-,15-13-,22-20-,28-26-,33-30+,37-31+/t42-/m1/s1 |
| InChIKey | SLJDINZGPLCWGQ-IHVYCOHXSA-N |
| XLogP | 11.49 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.04 |
| LogP ≤ 5 | 11.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|