C46H81NO8P+ — CID 156997119
2-[hydroxy-[(2R)-3-[(1E,11Z)-octadeca-1,11-dienoxy]-2-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156997119) has the molecular formula C46H81NO8P+ and a molecular weight of 807.13 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-3-[(1E,11Z)-octadeca-1,11-dienoxy]-2-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-3-[(1E,11Z)-octadeca-1,11-dienoxy]-2-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156997119 |
| Molecular Formula | C46H81NO8P+ |
| Molecular Weight | 807.13 g/mol |
| Exact Mass | 806.57 |
| IUPAC Name | 2-[hydroxy-[(2R)-3-[(1E,11Z)-octadeca-1,11-dienoxy]-2-[(6E,8Z,11Z,14Z)-5-oxoicosa-6,8,11,14-tetraenoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\C(=O)CCCC(=O)O[C@H](CO/C=C/CCCCCCCC/C=C\CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H80NO8P/c1-6-8-10-12-14-16-18-20-21-22-24-26-28-30-32-34-40-52-42-45(43-54-56(50,51)53-41-39-47(3,4)5)55-46(49)38-35-37-44(48)36-33-31-29-27-25-23-19-17-15-13-11-9-7-2/h15-18,23,25,29,31,33-34,36,40,45H,6-14,19-22,24,26-28,30,32,35,37-39,41-43H2,1-5H3/p+1/b17-15-,18-16-,25-23-,31-29-,36-33+,40-34+/t45-/m1/s1 |
| InChIKey | FCMXMBMWOZNFTC-SZZRFMJRSA-O |
| XLogP | 12.24 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.13 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|