C42H74NO9P — CID 156989192
[(2R)-3-[(5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156989192) has the molecular formula C42H74NO9P and a molecular weight of 768.03 g/mol. Its IUPAC name is [(2R)-3-[(5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156989192 |
| Molecular Formula | C42H74NO9P |
| Molecular Weight | 768.03 g/mol |
| Exact Mass | 767.51 |
| IUPAC Name | [(2R)-3-[(5E,8Z,11S,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C/C/C=C\C[C@H](O)/C=C\C=C/CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C42H74NO9P/c1-6-8-10-12-14-15-16-17-21-26-30-34-42(46)52-40(38-51-53(47,48)50-36-35-43(3,4)5)37-49-41(45)33-29-25-22-18-20-24-28-32-39(44)31-27-23-19-13-11-9-7-2/h12,14,18-19,22-24,27-28,31,39-40,44H,6-11,13,15-17,20-21,25-26,29-30,32-38H2,1-5H3/b14-12-,22-18+,23-19-,28-24-,31-27-/t39-,40-/m1/s1 |
| InChIKey | RNECKZNMCBVFIG-QJHXNHBWSA-N |
| XLogP | 9.24 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.03 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|