C46H84NO9P — CID 156992018
[(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156992018) has the molecular formula C46H84NO9P and a molecular weight of 826.15 g/mol. Its IUPAC name is [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156992018 |
| Molecular Formula | C46H84NO9P |
| Molecular Weight | 826.15 g/mol |
| Exact Mass | 825.59 |
| IUPAC Name | [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H84NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-23-27-30-34-38-46(50)56-44(42-55-57(51,52)54-40-39-47(3,4)5)41-53-45(49)37-33-29-26-24-21-22-25-28-32-36-43(48)35-31-9-7-2/h9,15-16,25,28,31-32,36,43-44,48H,6-8,10-14,17-24,26-27,29-30,33-35,37-42H2,1-5H3/b16-15-,28-25+,31-9+,36-32+/t43?,44-/m1/s1 |
| InChIKey | COAICNWFLHNNMF-RQZFFQRVSA-N |
| XLogP | 11.03 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.15 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|