C44H74NO9P — CID 156991602
[(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156991602) has the molecular formula C44H74NO9P and a molecular weight of 792.05 g/mol. Its IUPAC name is [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156991602 |
| Molecular Formula | C44H74NO9P |
| Molecular Weight | 792.05 g/mol |
| Exact Mass | 791.51 |
| IUPAC Name | [(2R)-3-[(9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoyl]oxy-2-[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/C=C/C(O)C/C=C/CC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H74NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-21-25-28-32-36-44(48)54-42(40-53-55(49,50)52-38-37-45(3,4)5)39-51-43(47)35-31-27-24-22-19-20-23-26-30-34-41(46)33-29-9-7-2/h8-10,12-13,15-16,18,21,23,26,29-30,34,41-42,46H,6-7,11,14,17,19-20,22,24-25,27-28,31-33,35-40H2,1-5H3/b10-8-,13-12-,16-15-,21-18-,26-23+,29-9+,34-30+/t41?,42-/m1/s1 |
| InChIKey | UXSOGWFOPGUYEO-ARZJQIQGSA-N |
| XLogP | 9.57 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.05 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|