C40H72NO9P — CID 156989256
[(2R)-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156989256) has the molecular formula C40H72NO9P and a molecular weight of 741.99 g/mol. Its IUPAC name is [(2R)-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156989256 |
| Molecular Formula | C40H72NO9P |
| Molecular Weight | 741.99 g/mol |
| Exact Mass | 741.49 |
| IUPAC Name | [(2R)-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C40H72NO9P/c1-6-8-10-11-12-13-14-17-21-24-28-32-40(44)50-38(36-49-51(45,46)48-34-33-41(3,4)5)35-47-39(43)31-27-23-20-18-15-16-19-22-26-30-37(42)29-25-9-7-2/h11-12,19,22,26,30,38H,6-10,13-18,20-21,23-25,27-29,31-36H2,1-5H3/b12-11-,22-19-,30-26+/t38-/m1/s1 |
| InChIKey | FUWRNJPEIKZLAK-SVVGCIENSA-N |
| XLogP | 9.12 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.99 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|