C44H78NO9P — CID 156990902
[(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156990902) has the molecular formula C44H78NO9P and a molecular weight of 796.08 g/mol. Its IUPAC name is [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156990902 |
| Molecular Formula | C44H78NO9P |
| Molecular Weight | 796.08 g/mol |
| Exact Mass | 795.54 |
| IUPAC Name | [(2R)-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxy-3-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H78NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-21-25-28-32-36-44(48)54-42(40-53-55(49,50)52-38-37-45(3,4)5)39-51-43(47)35-31-27-24-22-19-20-23-26-30-34-41(46)33-29-9-7-2/h12-13,15-16,23,26,30,34,42H,6-11,14,17-22,24-25,27-29,31-33,35-40H2,1-5H3/b13-12-,16-15-,26-23-,34-30+/t42-/m1/s1 |
| InChIKey | WSBWTQYBTNUEDX-HMUIQEKUSA-N |
| XLogP | 10.46 |
| TPSA | 128.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.08 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|