C46H82NO9P — CID 156990393
[(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156990393) has the molecular formula C46H82NO9P and a molecular weight of 824.13 g/mol. Its IUPAC name is [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156990393 |
| Molecular Formula | C46H82NO9P |
| Molecular Weight | 824.13 g/mol |
| Exact Mass | 823.57 |
| IUPAC Name | [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-octadec-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCO)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H82NO9P/c1-5-6-7-8-9-10-11-12-16-20-23-26-29-32-35-38-46(50)56-44(43-55-57(51,52)54-41-39-47(2,3)4)42-53-45(49)37-34-31-28-25-22-19-17-14-13-15-18-21-24-27-30-33-36-40-48/h10-11,13,15,17,19,21,24-25,28,44,48H,5-9,12,14,16,18,20,22-23,26-27,29-43H2,1-4H3/b11-10-,15-13-,19-17-,24-21-,28-25-/t44-/m1/s1 |
| InChIKey | XZEFKOHRKSYEGX-LJKITREVSA-N |
| XLogP | 10.80 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.13 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|