C48H86NO9P — CID 156991846
[(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156991846) has the molecular formula C48H86NO9P and a molecular weight of 852.19 g/mol. Its IUPAC name is [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156991846 |
| Molecular Formula | C48H86NO9P |
| Molecular Weight | 852.19 g/mol |
| Exact Mass | 851.60 |
| IUPAC Name | [(2R)-3-[(5Z,8Z,11Z,14Z)-20-hydroxyicosa-5,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)O[C@H](COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCO)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H86NO9P/c1-5-6-7-8-9-10-11-12-13-15-19-22-25-28-31-34-37-40-48(52)58-46(45-57-59(53,54)56-43-41-49(2,3)4)44-55-47(51)39-36-33-30-27-24-21-18-16-14-17-20-23-26-29-32-35-38-42-50/h12-14,17-18,21,23,26-27,30,46,50H,5-11,15-16,19-20,22,24-25,28-29,31-45H2,1-4H3/b13-12-,17-14-,21-18-,26-23-,30-27-/t46-/m1/s1 |
| InChIKey | PPJDPTORLQUCJF-KZFMKSIUSA-N |
| XLogP | 11.59 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.19 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|