C48H86NO9P — CID 156991850
[(2R)-3-[(5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156991850) has the molecular formula C48H86NO9P and a molecular weight of 852.19 g/mol. Its IUPAC name is [(2R)-3-[(5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156991850 |
| Molecular Formula | C48H86NO9P |
| Molecular Weight | 852.19 g/mol |
| Exact Mass | 851.60 |
| IUPAC Name | [(2R)-3-[(5S,6E,8Z,11Z,14Z)-5-hydroxyicosa-6,8,11,14-tetraenoyl]oxy-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C48H86NO9P/c1-6-8-10-12-14-16-18-20-21-22-23-25-27-29-31-33-35-39-48(52)58-46(44-57-59(53,54)56-42-41-49(3,4)5)43-55-47(51)40-36-38-45(50)37-34-32-30-28-26-24-19-17-15-13-11-9-7-2/h15,17,20-21,24,26,30,32,34,37,45-46,50H,6-14,16,18-19,22-23,25,27-29,31,33,35-36,38-44H2,1-5H3/b17-15-,21-20-,26-24-,32-30-,37-34+/t45-,46-/m1/s1 |
| InChIKey | LRPWJGMCEZBKHS-HXLACFRESA-N |
| XLogP | 11.58 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.19 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|