C51H86NO9P — CID 156994042
[(2R)-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxy-2-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156994042) has the molecular formula C51H86NO9P and a molecular weight of 888.22 g/mol. Its IUPAC name is [(2R)-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxy-2-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxy-2-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156994042 |
| Molecular Formula | C51H86NO9P |
| Molecular Weight | 888.22 g/mol |
| Exact Mass | 887.60 |
| IUPAC Name | [(2R)-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxy-2-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C51H86NO9P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-26-28-30-32-34-36-38-42-51(55)61-49(47-60-62(56,57)59-45-44-52(3,4)5)46-58-50(54)43-39-41-48(53)40-37-35-33-31-29-27-19-17-15-13-11-9-7-2/h9,11,15-18,21-22,24-25,27,29,33,35,37,40,48-49,53H,6-8,10,12-14,19-20,23,26,28,30-32,34,36,38-39,41-47H2,1-5H3/b11-9-,17-15-,18-16-,22-21-,25-24-,29-27-,35-33-,40-37+/t48?,49-/m1/s1 |
| InChIKey | VSGGHZSTCHOQPP-JTYWVSJOSA-N |
| XLogP | 12.08 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.22 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|