C44H78NO9P — CID 156990974
[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156990974) has the molecular formula C44H78NO9P and a molecular weight of 796.08 g/mol. Its IUPAC name is [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156990974 |
| Molecular Formula | C44H78NO9P |
| Molecular Weight | 796.08 g/mol |
| Exact Mass | 795.54 |
| IUPAC Name | [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C44H78NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-23-27-32-36-44(48)54-42(40-53-55(49,50)52-38-37-45(3,4)5)39-51-43(47)35-31-28-24-26-30-34-41(46)33-29-25-22-13-11-9-7-2/h9,11,14-15,17-18,22,25,29,33,41-42,46H,6-8,10,12-13,16,19-21,23-24,26-28,30-32,34-40H2,1-5H3/b11-9+,15-14-,18-17-,25-22+,33-29+/t41?,42-/m1/s1 |
| InChIKey | LNTWJLLRCZZLCP-BZXVNTCMSA-N |
| XLogP | 10.02 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.08 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|