C46H82NO9P — CID 156992218
[(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156992218) has the molecular formula C46H82NO9P and a molecular weight of 824.13 g/mol. Its IUPAC name is [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156992218 |
| Molecular Formula | C46H82NO9P |
| Molecular Weight | 824.13 g/mol |
| Exact Mass | 823.57 |
| IUPAC Name | [(2R)-3-[(10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoyl]oxy-2-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C46H82NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-29-34-38-46(50)56-44(42-55-57(51,52)54-40-39-47(3,4)5)41-53-45(49)37-33-30-26-28-32-36-43(48)35-31-27-24-13-11-9-7-2/h9,11,14-15,17-18,24,27,31,35,43-44,48H,6-8,10,12-13,16,19-23,25-26,28-30,32-34,36-42H2,1-5H3/b11-9+,15-14-,18-17-,27-24+,35-31+/t43?,44-/m1/s1 |
| InChIKey | LEMUMJDONXHLNG-NYZAEVOISA-N |
| XLogP | 10.80 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 824.13 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|