C46H81NO9P+ — CID 156992349
2-[hydroxy-[(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156992349) has the molecular formula C46H81NO9P+ and a molecular weight of 823.13 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156992349 |
| Molecular Formula | C46H81NO9P+ |
| Molecular Weight | 823.13 g/mol |
| Exact Mass | 822.56 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(5Z,8Z,11Z)-icosa-5,8,11-trienoyl]oxy-3-[(10E,12Z)-9-oxooctadeca-10,12-dienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C=C\C(=O)CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCC/C=C\C/C=C\C/C=C\CCCCCCCC |
| InChI | InChI=1S/C46H80NO9P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-23-25-29-34-38-46(50)56-44(42-55-57(51,52)54-40-39-47(3,4)5)41-53-45(49)37-33-30-26-28-32-36-43(48)35-31-27-24-13-11-9-7-2/h17-18,20-21,23-25,27,31,35,44H,6-16,19,22,26,28-30,32-34,36-42H2,1-5H3/p+1/b18-17-,21-20-,25-23-,27-24-,35-31+/t44-/m1/s1 |
| InChIKey | PWICHMQPYDGEGP-KMEFKAMNSA-O |
| XLogP | 11.64 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.13 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|