C49H87NO9P+ — CID 156994013
2-[hydroxy-[(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 156994013) has the molecular formula C49H87NO9P+ and a molecular weight of 865.21 g/mol. Its IUPAC name is 2-[hydroxy-[(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156994013 |
| Molecular Formula | C49H87NO9P+ |
| Molecular Weight | 865.21 g/mol |
| Exact Mass | 864.61 |
| IUPAC Name | 2-[hydroxy-[(2R)-2-[(9Z,11E)-13-oxooctadeca-9,11-dienoyl]oxy-3-[(10Z,13Z,16Z)-tricosa-10,13,16-trienoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCC/C=C\C/C=C\C/C=C\CCCCCCCCC(=O)OC[C@H](COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C=C\C(=O)CCCCC |
| InChI | InChI=1S/C49H86NO9P/c1-6-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-26-29-32-36-40-48(52)56-44-47(45-58-60(54,55)57-43-42-50(3,4)5)59-49(53)41-37-33-30-27-24-25-28-31-35-39-46(51)38-34-9-7-2/h13-14,16-17,19-20,28,31,35,39,47H,6-12,15,18,21-27,29-30,32-34,36-38,40-45H2,1-5H3/p+1/b14-13-,17-16-,20-19-,31-28-,39-35+/t47-/m1/s1 |
| InChIKey | CSDNIDQNLXHSHQ-VRRBSPPUSA-O |
| XLogP | 12.81 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.21 |
| LogP ≤ 5 | 12.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|