C48H82NO10P — CID 156995604
[(2R)-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156995604) has the molecular formula C48H82NO10P and a molecular weight of 864.15 g/mol. Its IUPAC name is [(2R)-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156995604 |
| Molecular Formula | C48H82NO10P |
| Molecular Weight | 864.15 g/mol |
| Exact Mass | 863.57 |
| IUPAC Name | [(2R)-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,15S)-15-hydroxyicosa-5,8,11,13-tetraenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC[C@H](O)/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H82NO10P/c1-8-10-26-32-43(50)33-27-22-18-14-12-11-13-15-21-25-30-36-48(52)58-44(40-57-60(53,54)56-38-37-49(5,6)7)39-55-47(51)35-29-24-20-17-16-19-23-28-34-46-42(4)41(3)45(59-46)31-9-2/h11-12,15,18,21-22,27,33,43-44,50H,8-10,13-14,16-17,19-20,23-26,28-32,34-40H2,1-7H3/b12-11-,21-15-,22-18-,33-27+/t43-,44+/m0/s1 |
| InChIKey | UBGYPTYLVKOLBI-DGNYWPOBSA-N |
| XLogP | 10.68 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.15 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|