C48H80NO10P — CID 156996536
[(2R)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156996536) has the molecular formula C48H80NO10P and a molecular weight of 862.14 g/mol. Its IUPAC name is [(2R)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156996536 |
| Molecular Formula | C48H80NO10P |
| Molecular Weight | 862.14 g/mol |
| Exact Mass | 861.55 |
| IUPAC Name | [(2R)-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]-3-[(6E,8Z,11Z,14Z,17Z)-5-hydroxyicosa-6,8,11,14,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C=C\C(O)CCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCc1oc(CCCCC)c(C)c1C |
| InChI | InChI=1S/C48H80NO10P/c1-8-10-12-13-14-15-16-17-18-19-20-23-27-31-43(50)32-30-36-47(51)55-39-44(40-57-60(53,54)56-38-37-49(5,6)7)58-48(52)35-29-25-22-21-24-28-34-46-42(4)41(3)45(59-46)33-26-11-9-2/h10,12,14-15,17-18,20,23,27,31,43-44,50H,8-9,11,13,16,19,21-22,24-26,28-30,32-40H2,1-7H3/b12-10-,15-14-,18-17-,23-20-,31-27+/t43?,44-/m1/s1 |
| InChIKey | OQNBCMDVDGLQFI-BQCWWZMASA-N |
| XLogP | 10.46 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.14 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|