C46H85NO11P+ — CID 156995681
2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 156995681) has the molecular formula C46H85NO11P+ and a molecular weight of 859.16 g/mol. Its IUPAC name is 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 156995681 |
| Molecular Formula | C46H85NO11P+ |
| Molecular Weight | 859.16 g/mol |
| Exact Mass | 858.59 |
| IUPAC Name | 2-[[(2R)-2-[(Z,9S,10S)-9,10-dihydroxyoctadec-12-enoyl]oxy-3-[11-(3,4-dimethyl-5-propylfuran-2-yl)undecanoyloxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\C[C@H](O)[C@@H](O)CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCCCc1oc(CCC)c(C)c1C)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H84NO11P/c1-8-10-11-12-18-23-29-41(48)42(49)30-24-19-17-22-27-33-46(51)57-40(37-56-59(52,53)55-35-34-47(5,6)7)36-54-45(50)32-26-21-16-14-13-15-20-25-31-44-39(4)38(3)43(58-44)28-9-2/h18,23,40-42,48-49H,8-17,19-22,24-37H2,1-7H3/p+1/b23-18-/t40-,41+,42+/m1/s1 |
| InChIKey | HEIPLSWUJQKEND-IRXKVTHJSA-O |
| XLogP | 10.18 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.16 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|