C48H84NO11P — CID 156996488
[(2R)-3-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156996488) has the molecular formula C48H84NO11P and a molecular weight of 882.17 g/mol. Its IUPAC name is [(2R)-3-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156996488 |
| Molecular Formula | C48H84NO11P |
| Molecular Weight | 882.17 g/mol |
| Exact Mass | 881.58 |
| IUPAC Name | [(2R)-3-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-2-[9-(3,4-dimethyl-5-pentylfuran-2-yl)nonanoyloxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O)C(O)CCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCc1oc(CCCCC)c(C)c1C |
| InChI | InChI=1S/C48H84NO11P/c1-8-10-12-13-14-15-16-17-18-19-22-26-30-43(50)44(51)31-29-35-47(52)56-38-42(39-58-61(54,55)57-37-36-49(5,6)7)59-48(53)34-28-24-21-20-23-27-33-46-41(4)40(3)45(60-46)32-25-11-9-2/h14-15,17-18,22,26,42-44,50-51H,8-13,16,19-21,23-25,27-39H2,1-7H3/b15-14-,18-17-,26-22-/t42-,43?,44?/m1/s1 |
| InChIKey | LBTKAMGKBCCQJS-MRVJGHRGSA-N |
| XLogP | 9.88 |
| TPSA | 164.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.17 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|