C42H76NO10P — CID 156989234
[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156989234) has the molecular formula C42H76NO10P and a molecular weight of 786.04 g/mol. Its IUPAC name is [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156989234 |
| Molecular Formula | C42H76NO10P |
| Molecular Weight | 786.04 g/mol |
| Exact Mass | 785.52 |
| IUPAC Name | [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCC(O)C(O)C/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C42H76NO10P/c1-6-8-10-12-14-16-18-20-21-23-25-27-30-39(44)40(45)31-29-33-42(47)53-38(37-52-54(48,49)51-35-34-43(3,4)5)36-50-41(46)32-28-26-24-22-19-17-15-13-11-9-7-2/h13-16,20-21,25,27,38-40,44-45H,6-12,17-19,22-24,26,28-37H2,1-5H3/b15-13-,16-14-,21-20-,27-25-/t38-,39?,40?/m1/s1 |
| InChIKey | JKNSTYJNVWIFRV-VBZTYIDJSA-N |
| XLogP | 8.44 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.04 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|