C48H86NO10P — CID 156992128
[(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156992128) has the molecular formula C48H86NO10P and a molecular weight of 868.19 g/mol. Its IUPAC name is [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156992128 |
| Molecular Formula | C48H86NO10P |
| Molecular Weight | 868.19 g/mol |
| Exact Mass | 867.60 |
| IUPAC Name | [(2R)-2-[(8Z,11Z,14Z)-5,6-dihydroxyicosa-8,11,14-trienoyl]oxy-3-[(11Z,14Z)-icosa-11,14-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CC(O)C(O)CCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C\C/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H86NO10P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-38-47(52)56-42-44(43-58-60(54,55)57-41-40-49(3,4)5)59-48(53)39-35-37-46(51)45(50)36-33-31-29-27-25-19-17-15-13-11-9-7-2/h14-17,20-21,25,27,31,33,44-46,50-51H,6-13,18-19,22-24,26,28-30,32,34-43H2,1-5H3/b16-14-,17-15-,21-20-,27-25-,33-31-/t44-,45?,46?/m1/s1 |
| InChIKey | PBTRPWOUNOJGNK-FERGAPGOSA-N |
| XLogP | 10.55 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.19 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|