C44H82NO10P — CID 156990906
[(2R)-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156990906) has the molecular formula C44H82NO10P and a molecular weight of 816.11 g/mol. Its IUPAC name is [(2R)-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156990906 |
| Molecular Formula | C44H82NO10P |
| Molecular Weight | 816.11 g/mol |
| Exact Mass | 815.57 |
| IUPAC Name | [(2R)-3-[(Z,9R,10R)-9,10-dihydroxyoctadec-12-enoyl]oxy-2-[(9Z,12Z)-octadeca-9,12-dienoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC[C@@H](O)[C@H](O)C/C=C\CCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C44H82NO10P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-26-31-35-44(49)55-40(39-54-56(50,51)53-37-36-45(3,4)5)38-52-43(48)34-30-27-23-25-29-33-42(47)41(46)32-28-24-13-11-9-7-2/h14-15,17-18,24,28,40-42,46-47H,6-13,16,19-23,25-27,29-39H2,1-5H3/b15-14-,18-17-,28-24-/t40-,41-,42-/m1/s1 |
| InChIKey | DRNJYMRTBABTKD-WWHWBEMDSA-N |
| XLogP | 9.44 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.11 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|