C50H84NO10P — CID 156995904
[(2R)-3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156995904) has the molecular formula C50H84NO10P and a molecular weight of 890.19 g/mol. Its IUPAC name is [(2R)-3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156995904 |
| Molecular Formula | C50H84NO10P |
| Molecular Weight | 890.19 g/mol |
| Exact Mass | 889.58 |
| IUPAC Name | [(2R)-3-[11-(3,4-dimethyl-5-pentylfuran-2-yl)undecanoyloxy]-2-[(5Z,8Z,11Z,13E,17Z)-16-hydroxyicosa-5,8,11,13,17-pentaenoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C(O)C/C=C/C=C\C/C=C\C/C=C\CCCC(=O)O[C@H](COC(=O)CCCCCCCCCCc1oc(CCCCC)c(C)c1C)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C50H84NO10P/c1-8-10-28-35-47-43(3)44(4)48(61-47)36-30-25-21-18-19-22-26-31-37-49(53)57-41-46(42-59-62(55,56)58-40-39-51(5,6)7)60-50(54)38-32-27-23-17-15-13-12-14-16-20-24-29-34-45(52)33-11-9-2/h11-13,16-17,20,23-24,29,33,45-46,52H,8-10,14-15,18-19,21-22,25-28,30-32,34-42H2,1-7H3/b13-12-,20-16-,23-17-,29-24+,33-11-/t45?,46-/m1/s1 |
| InChIKey | ZTFKWQDRZLFCMD-ZIMVLKPKSA-N |
| XLogP | 11.24 |
| TPSA | 144.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.19 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|