C48H82NO8P — CID 156997394
[(2R)-2-[(4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997394) has the molecular formula C48H82NO8P and a molecular weight of 832.16 g/mol. Its IUPAC name is [(2R)-2-[(4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997394 |
| Molecular Formula | C48H82NO8P |
| Molecular Weight | 832.16 g/mol |
| Exact Mass | 831.58 |
| IUPAC Name | [(2R)-2-[(4Z,7Z,10Z,12E,16Z,19Z)-14-hydroxydocosa-4,7,10,12,16,19-hexaenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\CC(O)/C=C/C=C\C/C=C\C/C=C\CCC(=O)O[C@H](CO/C=C/CCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C48H82NO8P/c1-6-8-10-12-14-15-16-17-18-19-20-23-26-29-33-37-42-54-44-47(45-56-58(52,53)55-43-41-49(3,4)5)57-48(51)40-36-32-28-25-22-21-24-27-31-35-39-46(50)38-34-30-13-11-9-7-2/h9,11,17-18,21-22,27-28,30-32,34-35,37,39,42,46-47,50H,6-8,10,12-16,19-20,23-26,29,33,36,38,40-41,43-45H2,1-5H3/b11-9-,18-17-,22-21-,31-27-,32-28-,34-30-,39-35+,42-37+/t46?,47-/m1/s1 |
| InChIKey | OWVYEYGFXSRPJD-USMJWUFFSA-N |
| XLogP | 11.73 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.16 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|