C46H82NO8P — CID 156997274
[(2R)-2-[(5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 156997274) has the molecular formula C46H82NO8P and a molecular weight of 808.13 g/mol. Its IUPAC name is [(2R)-2-[(5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [(2R)-2-[(5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 156997274 |
| Molecular Formula | C46H82NO8P |
| Molecular Weight | 808.13 g/mol |
| Exact Mass | 807.58 |
| IUPAC Name | [(2R)-2-[(5E,8Z,11R,12Z,14Z)-11-hydroxyicosa-5,8,12,14-tetraenoyl]oxy-3-[(1E,9Z)-octadeca-1,9-dienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCC/C=C\C=C/[C@H](O)C/C=C\C/C=C/CCCC(=O)O[C@H](CO/C=C/CCCCCC/C=C\CCCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C46H82NO8P/c1-6-8-10-12-14-15-16-17-18-19-20-21-22-27-31-35-40-52-42-45(43-54-56(50,51)53-41-39-47(3,4)5)55-46(49)38-34-30-26-23-25-29-33-37-44(48)36-32-28-24-13-11-9-7-2/h17-18,23-24,26,28-29,32-33,35-36,40,44-45,48H,6-16,19-22,25,27,30-31,34,37-39,41-43H2,1-5H3/b18-17-,26-23+,28-24-,33-29-,36-32-,40-35+/t44-,45+/m0/s1 |
| InChIKey | JFHZYBUHLJXRFR-CTWYPIAHSA-N |
| XLogP | 11.40 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.13 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|