C33H56O6 — CID 157002543
[(2S)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoate (PubChem CID 157002543) has the molecular formula C33H56O6 and a molecular weight of 548.81 g/mol. Its IUPAC name is [(2S)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoate.
| Compound Name | [(2S)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 157002543 |
| Molecular Formula | C33H56O6 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.41 |
| IUPAC Name | [(2S)-3-decanoyloxy-2-hydroxypropyl] (5Z,8Z,11Z,14Z,16S)-16-hydroxyicosa-5,8,11,14-tetraenoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](O)COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\[C@@H](O)CCCC |
| InChI | InChI=1S/C33H56O6/c1-3-5-7-8-15-19-22-26-32(36)38-28-31(35)29-39-33(37)27-23-20-17-14-12-10-9-11-13-16-18-21-25-30(34)24-6-4-2/h9-10,13-14,16-17,21,25,30-31,34-35H,3-8,11-12,15,18-20,22-24,26-29H2,1-2H3/b10-9-,16-13-,17-14-,25-21-/t30-,31-/m0/s1 |
| InChIKey | KJTHBJVAJDQGJE-TVQWIDJVSA-N |
| XLogP | 7.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|