C35H56O7 — CID 157002649
[(2S)-2-decanoyloxy-3-hydroxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate (PubChem CID 157002649) has the molecular formula C35H56O7 and a molecular weight of 588.83 g/mol. Its IUPAC name is [(2S)-2-decanoyloxy-3-hydroxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate.
| Compound Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 157002649 |
| Molecular Formula | C35H56O7 |
| Molecular Weight | 588.83 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | [(2S)-2-decanoyloxy-3-hydroxypropyl] (5Z,7S,8E,10Z,13Z,15E,17R,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](O)/C=C/C=C\C/C=C\C=C\[C@@H](O)/C=C\CCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C35H56O7/c1-3-5-7-8-10-15-21-28-35(40)42-33(29-36)30-41-34(39)27-22-16-20-26-32(38)25-19-14-12-9-11-13-18-24-31(37)23-17-6-4-2/h6,11-14,17-20,24-26,31-33,36-38H,3-5,7-10,15-16,21-23,27-30H2,1-2H3/b13-11-,14-12-,17-6-,24-18+,25-19+,26-20-/t31-,32-,33+/m1/s1 |
| InChIKey | AICMHQLIOMYZAY-CKJZHLHBSA-N |
| XLogP | 6.99 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.83 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|