C27H40O7 — CID 157005098
[(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (5Z,7R,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate (PubChem CID 157005098) has the molecular formula C27H40O7 and a molecular weight of 476.61 g/mol. Its IUPAC name is [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (5Z,7R,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate.
| Compound Name | [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (5Z,7R,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 157005098 |
| Molecular Formula | C27H40O7 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | [(2S)-1-acetyloxy-3-hydroxypropan-2-yl] (5Z,7R,8E,10Z,13Z,15E,17S,19Z)-7,17-dihydroxydocosa-5,8,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@H](O)/C=C/C=C\C/C=C\C=C\[C@H](O)/C=C\CCCC(=O)O[C@@H](CO)COC(C)=O |
| InChI | InChI=1S/C27H40O7/c1-3-4-11-16-24(30)17-12-8-6-5-7-9-13-18-25(31)19-14-10-15-20-27(32)34-26(21-28)22-33-23(2)29/h4,6-9,11-14,17-19,24-26,28,30-31H,3,5,10,15-16,20-22H2,1-2H3/b8-6-,9-7-,11-4-,17-12+,18-13+,19-14-/t24-,25-,26-/m0/s1 |
| InChIKey | KFVZMKFDTNHWBZ-RFCKWKLGSA-N |
| XLogP | 3.87 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|