C34H60O6 — CID 157005559
[(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate (PubChem CID 157005559) has the molecular formula C34H60O6 and a molecular weight of 564.85 g/mol. Its IUPAC name is [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate.
| Compound Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
|---|---|
| PubChem CID | 157005559 |
| Molecular Formula | C34H60O6 |
| Molecular Weight | 564.85 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | [(2S)-3-hydroxy-2-(10-methyldodecanoyloxy)propyl] (9E,11E,15E)-13-hydroxyoctadeca-9,11,15-trienoate |
| SMILES | CC/C=C/CC(O)/C=C/C=C/CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCC(C)CC |
| InChI | InChI=1S/C34H60O6/c1-4-6-18-24-31(36)25-20-15-10-8-7-9-11-16-21-26-33(37)39-29-32(28-35)40-34(38)27-22-17-13-12-14-19-23-30(3)5-2/h6,10,15,18,20,25,30-32,35-36H,4-5,7-9,11-14,16-17,19,21-24,26-29H2,1-3H3/b15-10+,18-6+,25-20+/t30?,31?,32-/m0/s1 |
| InChIKey | SBBKXIMUVDEEST-UGIXEXOFSA-N |
| XLogP | 8.16 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.85 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|